C15H11ClN4S — CID 135380905
5-[2-[(6-chloropyrimidin-4-yl)amino]ethyl]-1-benzothiophene-3-carbonitrile (PubChem CID 135380905) has the molecular formula C15H11ClN4S and a molecular weight of 314.80 g/mol. Its IUPAC name is 5-[2-[(6-chloropyrimidin-4-yl)amino]ethyl]-1-benzothiophene-3-carbonitrile.
| Compound Name | 5-[2-[(6-chloropyrimidin-4-yl)amino]ethyl]-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 135380905 |
| Molecular Formula | C15H11ClN4S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-[2-[(6-chloropyrimidin-4-yl)amino]ethyl]-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1csc2ccc(CCNc3cc(Cl)ncn3)cc12 |
| InChI | InChI=1S/C15H11ClN4S/c16-14-6-15(20-9-19-14)18-4-3-10-1-2-13-12(5-10)11(7-17)8-21-13/h1-2,5-6,8-9H,3-4H2,(H,18,19,20) |
| InChIKey | DBNCTLUDKBYQKH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |