C15H14ClN3OS — CID 135380239
6-chloro-N-[2-(5-methoxy-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 135380239) has the molecular formula C15H14ClN3OS and a molecular weight of 319.82 g/mol. Its IUPAC name is 6-chloro-N-[2-(5-methoxy-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-(5-methoxy-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135380239 |
| Molecular Formula | C15H14ClN3OS |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-chloro-N-[2-(5-methoxy-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | COc1ccc2sccc2c1CCNc1cc(Cl)ncn1 |
| InChI | InChI=1S/C15H14ClN3OS/c1-20-12-2-3-13-11(5-7-21-13)10(12)4-6-17-15-8-14(16)18-9-19-15/h2-3,5,7-9H,4,6H2,1H3,(H,17,18,19) |
| InChIKey | UAAQXIVFVSGCFO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |