C17H23NO3S — CID 142473089
tert-butyl N-[2-(5-ethoxy-1-benzothiophen-4-yl)ethyl]carbamate (PubChem CID 142473089) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is tert-butyl N-[2-(5-ethoxy-1-benzothiophen-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-ethoxy-1-benzothiophen-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 142473089 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | tert-butyl N-[2-(5-ethoxy-1-benzothiophen-4-yl)ethyl]carbamate |
| SMILES | CCOc1ccc2sccc2c1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO3S/c1-5-20-14-6-7-15-13(9-11-22-15)12(14)8-10-18-16(19)21-17(2,3)4/h6-7,9,11H,5,8,10H2,1-4H3,(H,18,19) |
| InChIKey | OPMGIQPNKZUKRB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |