C21H34N2O5S — CID 84557364
tert-butyl N-[2-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84557364) has the molecular formula C21H34N2O5S and a molecular weight of 426.58 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84557364 |
| Molecular Formula | C21H34N2O5S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CCOc1ccc(CCNC(=O)CSCCNC(=O)OC(C)(C)C)cc1OCC |
| InChI | InChI=1S/C21H34N2O5S/c1-6-26-17-9-8-16(14-18(17)27-7-2)10-11-22-19(24)15-29-13-12-23-20(25)28-21(3,4)5/h8-9,14H,6-7,10-13,15H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | APZLOSMJZNUZKK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|