C17H23NO4 — CID 142472796
tert-butyl N-[2-(6-methoxy-4-methyl-1-benzofuran-5-yl)ethyl]carbamate (PubChem CID 142472796) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is tert-butyl N-[2-(6-methoxy-4-methyl-1-benzofuran-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-methoxy-4-methyl-1-benzofuran-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 142472796 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl N-[2-(6-methoxy-4-methyl-1-benzofuran-5-yl)ethyl]carbamate |
| SMILES | COc1cc2occc2c(C)c1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO4/c1-11-12(6-8-18-16(19)22-17(2,3)4)14(20-5)10-15-13(11)7-9-21-15/h7,9-10H,6,8H2,1-5H3,(H,18,19) |
| InChIKey | ASAJMOMDJOTEBY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |