C17H22N2O4 — CID 59722487
tert-butyl N-[3-(1-benzofuran-5-ylmethylamino)-3-oxopropyl]carbamate (PubChem CID 59722487) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl N-[3-(1-benzofuran-5-ylmethylamino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(1-benzofuran-5-ylmethylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 59722487 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl N-[3-(1-benzofuran-5-ylmethylamino)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccc2occc2c1 |
| InChI | InChI=1S/C17H22N2O4/c1-17(2,3)23-16(21)18-8-6-15(20)19-11-12-4-5-14-13(10-12)7-9-22-14/h4-5,7,9-10H,6,8,11H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | SHMIIZUDVKWVPM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |