C19H29N3O3S — CID 47059291
tert-butyl N-[3-oxo-3-[(4-thiomorpholin-4-ylphenyl)methylamino]propyl]carbamate (PubChem CID 47059291) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[(4-thiomorpholin-4-ylphenyl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[(4-thiomorpholin-4-ylphenyl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 47059291 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[(4-thiomorpholin-4-ylphenyl)methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-19(2,3)25-18(24)20-9-8-17(23)21-14-15-4-6-16(7-5-15)22-10-12-26-13-11-22/h4-7H,8-14H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | NKFBNEVJQGIZLA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|