C18H28N2O4 — CID 37358112
tert-butyl N-[3-[[4-(ethoxymethyl)phenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 37358112) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(ethoxymethyl)phenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(ethoxymethyl)phenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 37358112 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-[3-[[4-(ethoxymethyl)phenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | CCOCc1ccc(CNC(=O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-5-23-13-15-8-6-14(7-9-15)12-20-16(21)10-11-19-17(22)24-18(2,3)4/h6-9H,5,10-13H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | AKBNIPUIKZBUSB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |