C18H24N4O3 — CID 47057073
tert-butyl N-[3-oxo-3-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]propyl]carbamate (PubChem CID 47057073) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 47057073 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2,3)25-17(24)19-10-9-16(23)20-12-13-4-6-14(7-5-13)15-8-11-21-22-15/h4-8,11H,9-10,12H2,1-3H3,(H,19,24)(H,20,23)(H,21,22) |
| InChIKey | UVLWLLFSCHRCCD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |