C17H21FN2O5 — CID 118074756
6-fluoro-5-methoxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-2-carboxylic acid (PubChem CID 118074756) has the molecular formula C17H21FN2O5 and a molecular weight of 352.36 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 6-fluoro-5-methoxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 118074756 |
| Molecular Formula | C17H21FN2O5 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 6-fluoro-5-methoxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-2-carboxylic acid |
| SMILES | COc1cc2c(CCNC(=O)OC(C)(C)C)c(C(=O)O)[nH]c2cc1F |
| InChI | InChI=1S/C17H21FN2O5/c1-17(2,3)25-16(23)19-6-5-9-10-7-13(24-4)11(18)8-12(10)20-14(9)15(21)22/h7-8,20H,5-6H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | MFKASLLWWDFHOF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|