C23H27FN2O2 — CID 21263072
N-[2-[2-(3-ethylphenyl)-6-fluoro-5-methoxy-1H-indol-3-yl]ethyl]butanamide (PubChem CID 21263072) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[2-[2-(3-ethylphenyl)-6-fluoro-5-methoxy-1H-indol-3-yl]ethyl]butanamide.
| Compound Name | N-[2-[2-(3-ethylphenyl)-6-fluoro-5-methoxy-1H-indol-3-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 21263072 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[2-[2-(3-ethylphenyl)-6-fluoro-5-methoxy-1H-indol-3-yl]ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1c(-c2cccc(CC)c2)[nH]c2cc(F)c(OC)cc12 |
| InChI | InChI=1S/C23H27FN2O2/c1-4-7-22(27)25-11-10-17-18-13-21(28-3)19(24)14-20(18)26-23(17)16-9-6-8-15(5-2)12-16/h6,8-9,12-14,26H,4-5,7,10-11H2,1-3H3,(H,25,27) |
| InChIKey | ACMJHPUVYIJRSS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |