C27H25FN2O4 — CID 55413065
methyl 5-[[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]methyl]-2-methoxybenzoate (PubChem CID 55413065) has the molecular formula C27H25FN2O4 and a molecular weight of 460.51 g/mol. Its IUPAC name is methyl 5-[[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 55413065 |
| Molecular Formula | C27H25FN2O4 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | methyl 5-[[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)CCc2c(-c3ccc(F)cc3)[nH]c3ccccc23)ccc1OC |
| InChI | InChI=1S/C27H25FN2O4/c1-33-24-13-7-17(15-22(24)27(32)34-2)16-29-25(31)14-12-21-20-5-3-4-6-23(20)30-26(21)18-8-10-19(28)11-9-18/h3-11,13,15,30H,12,14,16H2,1-2H3,(H,29,31) |
| InChIKey | SREWTSAKSLHVBG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |