C20H18FN3O4 — CID 86930860
methyl 5-[[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]methyl]-2-methoxybenzoate (PubChem CID 86930860) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is methyl 5-[[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 86930860 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | methyl 5-[[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2cc(-c3ccc(F)cc3)n[nH]2)ccc1OC |
| InChI | InChI=1S/C20H18FN3O4/c1-27-18-8-3-12(9-15(18)20(26)28-2)11-22-19(25)17-10-16(23-24-17)13-4-6-14(21)7-5-13/h3-10H,11H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | WROFURWGKXWVJC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |