C19H17F2N3O3 — CID 40705938
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 40705938) has the molecular formula C19H17F2N3O3 and a molecular weight of 373.36 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 40705938 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | COc1cc(CNC(=O)c2cc(-c3ccccc3)n[nH]2)ccc1OC(F)F |
| InChI | InChI=1S/C19H17F2N3O3/c1-26-17-9-12(7-8-16(17)27-19(20)21)11-22-18(25)15-10-14(23-24-15)13-5-3-2-4-6-13/h2-10,19H,11H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | IVEKYDGRYYCYEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |