C15H14F2N2O3S — CID 43046574
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 43046574) has the molecular formula C15H14F2N2O3S and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43046574 |
| Molecular Formula | C15H14F2N2O3S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | COc1cc(CNC(=O)c2ccc[nH]c2=S)ccc1OC(F)F |
| InChI | InChI=1S/C15H14F2N2O3S/c1-21-12-7-9(4-5-11(12)22-15(16)17)8-19-13(20)10-3-2-6-18-14(10)23/h2-7,15H,8H2,1H3,(H,18,23)(H,19,20) |
| InChIKey | JQZSSXMVFRJASX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|