C19H20N4O4S — CID 50751661
3-(4-methoxy-3-sulfamoylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 50751661) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 3-(4-methoxy-3-sulfamoylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methoxy-3-sulfamoylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 50751661 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-(4-methoxy-3-sulfamoylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCc3ccc(C)cc3)[nH]n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H20N4O4S/c1-12-3-5-13(6-4-12)11-21-19(24)16-10-15(22-23-16)14-7-8-17(27-2)18(9-14)28(20,25)26/h3-10H,11H2,1-2H3,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | OLYGXFGDCOAOMN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |