C19H20N4O4S — CID 50751622
N-benzyl-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 50751622) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-benzyl-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 50751622 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-benzyl-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(-c2cc(C(=O)NCc3ccccc3)[nH]n2)ccc1OC |
| InChI | InChI=1S/C19H20N4O4S/c1-20-28(25,26)18-10-14(8-9-17(18)27-2)15-11-16(23-22-15)19(24)21-12-13-6-4-3-5-7-13/h3-11,20H,12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | FTIDECVLNCPXHX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |