C19H20N4O5S — CID 50751701
N-(2-ethoxyphenyl)-3-(4-methoxy-3-sulfamoylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 50751701) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-3-(4-methoxy-3-sulfamoylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-3-(4-methoxy-3-sulfamoylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 50751701 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-(2-ethoxyphenyl)-3-(4-methoxy-3-sulfamoylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1cc(-c2ccc(OC)c(S(N)(=O)=O)c2)n[nH]1 |
| InChI | InChI=1S/C19H20N4O5S/c1-3-28-16-7-5-4-6-13(16)21-19(24)15-11-14(22-23-15)12-8-9-17(27-2)18(10-12)29(20,25)26/h4-11H,3H2,1-2H3,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | WNPUXAMVXJBFJR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |