C18H18N4O4S — CID 50751687
3-(4-methoxy-3-sulfamoylphenyl)-N-(2-methylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 50751687) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-(4-methoxy-3-sulfamoylphenyl)-N-(2-methylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methoxy-3-sulfamoylphenyl)-N-(2-methylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 50751687 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-(4-methoxy-3-sulfamoylphenyl)-N-(2-methylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccccc3C)[nH]n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H18N4O4S/c1-11-5-3-4-6-13(11)20-18(23)15-10-14(21-22-15)12-7-8-16(26-2)17(9-12)27(19,24)25/h3-10H,1-2H3,(H,20,23)(H,21,22)(H2,19,24,25) |
| InChIKey | HVZVFBFAFUUJKG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |