C22H24N2O4 — CID 51156523
methyl 5-[[4-(1H-indol-3-yl)butanoylamino]methyl]-2-methoxybenzoate (PubChem CID 51156523) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 5-[[4-(1H-indol-3-yl)butanoylamino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[4-(1H-indol-3-yl)butanoylamino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 51156523 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 5-[[4-(1H-indol-3-yl)butanoylamino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)CCCc2c[nH]c3ccccc23)ccc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-27-20-11-10-15(12-18(20)22(26)28-2)13-24-21(25)9-5-6-16-14-23-19-8-4-3-7-17(16)19/h3-4,7-8,10-12,14,23H,5-6,9,13H2,1-2H3,(H,24,25) |
| InChIKey | JRHBNTYMVIVSLN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |