C16H21F2NO3 — CID 66982908
tert-butyl N-[(Z)-3-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enyl]carbamate (PubChem CID 66982908) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is tert-butyl N-[(Z)-3-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-3-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 66982908 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl N-[(Z)-3-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enyl]carbamate |
| SMILES | COc1ccc(C/C(=C/F)CNC(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C16H21F2NO3/c1-16(2,3)22-15(20)19-10-12(9-17)7-11-5-6-14(21-4)13(18)8-11/h5-6,8-9H,7,10H2,1-4H3,(H,19,20)/b12-9- |
| InChIKey | GZLSMYZSCHHVKI-XFXZXTDPSA-N |
| XLogP | 3.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |