C15H20FNO3 — CID 59988320
tert-butyl N-[[2-fluoro-4-(3-oxopropyl)phenyl]methyl]carbamate (PubChem CID 59988320) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl N-[[2-fluoro-4-(3-oxopropyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-fluoro-4-(3-oxopropyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59988320 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-[[2-fluoro-4-(3-oxopropyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CCC=O)cc1F |
| InChI | InChI=1S/C15H20FNO3/c1-15(2,3)20-14(19)17-10-12-7-6-11(5-4-8-18)9-13(12)16/h6-9H,4-5,10H2,1-3H3,(H,17,19) |
| InChIKey | JDENOEQIGDVCNC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|