C19H26FN3O3 — CID 163390536
tert-butyl N-[[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxymethyl]phenyl]methyl]carbamate (PubChem CID 163390536) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is tert-butyl N-[[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxymethyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxymethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 163390536 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | tert-butyl N-[[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxymethyl]phenyl]methyl]carbamate |
| SMILES | Cn1ccnc1CCOCc1ccc(CNC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C19H26FN3O3/c1-19(2,3)26-18(24)22-12-15-6-5-14(11-16(15)20)13-25-10-7-17-21-8-9-23(17)4/h5-6,8-9,11H,7,10,12-13H2,1-4H3,(H,22,24) |
| InChIKey | KUTLFSVMDJBSNG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|