C17H28FN3O2 — CID 142209831
tert-butyl N-[[4-[3-(2-aminoethylamino)propyl]-2-fluorophenyl]methyl]carbamate (PubChem CID 142209831) has the molecular formula C17H28FN3O2 and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl N-[[4-[3-(2-aminoethylamino)propyl]-2-fluorophenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[3-(2-aminoethylamino)propyl]-2-fluorophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142209831 |
| Molecular Formula | C17H28FN3O2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | tert-butyl N-[[4-[3-(2-aminoethylamino)propyl]-2-fluorophenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CCCNCCN)cc1F |
| InChI | InChI=1S/C17H28FN3O2/c1-17(2,3)23-16(22)21-12-14-7-6-13(11-15(14)18)5-4-9-20-10-8-19/h6-7,11,20H,4-5,8-10,12,19H2,1-3H3,(H,21,22) |
| InChIKey | GVERWRGOJCSXQO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|