C15H23NO4S2 — CID 11420477
tert-butyl N-[2-[4,5-dimethoxy-2,3-bis(sulfanyl)phenyl]ethyl]carbamate (PubChem CID 11420477) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is tert-butyl N-[2-[4,5-dimethoxy-2,3-bis(sulfanyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4,5-dimethoxy-2,3-bis(sulfanyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 11420477 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | tert-butyl N-[2-[4,5-dimethoxy-2,3-bis(sulfanyl)phenyl]ethyl]carbamate |
| SMILES | COc1cc(CCNC(=O)OC(C)(C)C)c(S)c(S)c1OC |
| InChI | InChI=1S/C15H23NO4S2/c1-15(2,3)20-14(17)16-7-6-9-8-10(18-4)11(19-5)13(22)12(9)21/h8,21-22H,6-7H2,1-5H3,(H,16,17) |
| InChIKey | VPHMLFFJHOEVQY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|