C16H23NO5 — CID 167345934
tert-butyl N-[2-(2-acetyl-5-hydroxy-4-methoxyphenyl)ethyl]carbamate (PubChem CID 167345934) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is tert-butyl N-[2-(2-acetyl-5-hydroxy-4-methoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-acetyl-5-hydroxy-4-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 167345934 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | tert-butyl N-[2-(2-acetyl-5-hydroxy-4-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1cc(C(C)=O)c(CCNC(=O)OC(C)(C)C)cc1O |
| InChI | InChI=1S/C16H23NO5/c1-10(18)12-9-14(21-5)13(19)8-11(12)6-7-17-15(20)22-16(2,3)4/h8-9,19H,6-7H2,1-5H3,(H,17,20) |
| InChIKey | HIEDBTWSRZOLRK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |