C22H37NO6Si — CID 167346069
tert-butyl N-[2-[2-acetyl-4-methoxy-5-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]carbamate (PubChem CID 167346069) has the molecular formula C22H37NO6Si and a molecular weight of 439.63 g/mol. Its IUPAC name is tert-butyl N-[2-[2-acetyl-4-methoxy-5-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-acetyl-4-methoxy-5-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 167346069 |
| Molecular Formula | C22H37NO6Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | tert-butyl N-[2-[2-acetyl-4-methoxy-5-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]carbamate |
| SMILES | COc1cc(C(C)=O)c(CCNC(=O)OC(C)(C)C)cc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C22H37NO6Si/c1-16(24)18-14-19(26-5)20(28-15-27-11-12-30(6,7)8)13-17(18)9-10-23-21(25)29-22(2,3)4/h13-14H,9-12,15H2,1-8H3,(H,23,25) |
| InChIKey | HBTOQWVJJDQJII-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|