C31H34BrNO5 — CID 167345979
tert-butyl N-[2-[2-[(E)-3-(5-bromo-2-methylphenyl)prop-2-enoyl]-4-methoxy-5-phenylmethoxyphenyl]ethyl]carbamate (PubChem CID 167345979) has the molecular formula C31H34BrNO5 and a molecular weight of 580.52 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(E)-3-(5-bromo-2-methylphenyl)prop-2-enoyl]-4-methoxy-5-phenylmethoxyphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(E)-3-(5-bromo-2-methylphenyl)prop-2-enoyl]-4-methoxy-5-phenylmethoxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 167345979 |
| Molecular Formula | C31H34BrNO5 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | tert-butyl N-[2-[2-[(E)-3-(5-bromo-2-methylphenyl)prop-2-enoyl]-4-methoxy-5-phenylmethoxyphenyl]ethyl]carbamate |
| SMILES | COc1cc(C(=O)/C=C/c2cc(Br)ccc2C)c(CCNC(=O)OC(C)(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H34BrNO5/c1-21-11-13-25(32)17-23(21)12-14-27(34)26-19-28(36-5)29(37-20-22-9-7-6-8-10-22)18-24(26)15-16-33-30(35)38-31(2,3)4/h6-14,17-19H,15-16,20H2,1-5H3,(H,33,35)/b14-12+ |
| InChIKey | YHZSXUZQPZQQII-WYMLVPIESA-N |
| XLogP | 7.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|