C21H35N3O4Si — CID 168946645
tert-butyl N-[2-[5-methoxy-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]ethyl]carbamate (PubChem CID 168946645) has the molecular formula C21H35N3O4Si and a molecular weight of 421.61 g/mol. Its IUPAC name is tert-butyl N-[2-[5-methoxy-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-methoxy-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 168946645 |
| Molecular Formula | C21H35N3O4Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl N-[2-[5-methoxy-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]ethyl]carbamate |
| SMILES | COc1ccc2c(c1)c(CCNC(=O)OC(C)(C)C)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H35N3O4Si/c1-21(2,3)28-20(25)22-11-10-18-17-14-16(26-4)8-9-19(17)24(23-18)15-27-12-13-29(5,6)7/h8-9,14H,10-13,15H2,1-7H3,(H,22,25) |
| InChIKey | YIZXOZYLIUFWPR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|