C14H26IN3O3Si — CID 66851624
tert-butyl N-[5-iodo-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate (PubChem CID 66851624) has the molecular formula C14H26IN3O3Si and a molecular weight of 439.37 g/mol. Its IUPAC name is tert-butyl N-[5-iodo-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-iodo-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 66851624 |
| Molecular Formula | C14H26IN3O3Si |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | tert-butyl N-[5-iodo-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnn(COCC[Si](C)(C)C)c1I |
| InChI | InChI=1S/C14H26IN3O3Si/c1-14(2,3)21-13(19)17-11-9-16-18(12(11)15)10-20-7-8-22(4,5)6/h9H,7-8,10H2,1-6H3,(H,17,19) |
| InChIKey | VGWOJUHKCRUQPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|