C26H39N5O3Si — CID 131746588
tert-butyl N-[5-[[[(1R)-1-phenylethyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]carbamate (PubChem CID 131746588) has the molecular formula C26H39N5O3Si and a molecular weight of 497.72 g/mol. Its IUPAC name is tert-butyl N-[5-[[[(1R)-1-phenylethyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[[(1R)-1-phenylethyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 131746588 |
| Molecular Formula | C26H39N5O3Si |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | tert-butyl N-[5-[[[(1R)-1-phenylethyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]carbamate |
| SMILES | C[C@@H](NCc1nc2cnn(COCC[Si](C)(C)C)c2cc1NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H39N5O3Si/c1-19(20-11-9-8-10-12-20)27-16-22-21(30-25(32)34-26(2,3)4)15-24-23(29-22)17-28-31(24)18-33-13-14-35(5,6)7/h8-12,15,17,19,27H,13-14,16,18H2,1-7H3,(H,30,32)/t19-/m1/s1 |
| InChIKey | CDWNFXXVZNMHRT-LJQANCHMSA-N |
| XLogP | 5.94 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|