C24H36N4O5Si — CID 174999555
tert-butyl N-[1-[3-[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamate (PubChem CID 174999555) has the molecular formula C24H36N4O5Si and a molecular weight of 488.66 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 174999555 |
| Molecular Formula | C24H36N4O5Si |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | tert-butyl N-[1-[3-[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)c1cccc(-c2c([N+](=O)[O-])cnn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H36N4O5Si/c1-8-10-20(26-23(29)33-24(2,3)4)18-11-9-12-19(15-18)22-21(28(30)31)16-25-27(22)17-32-13-14-34(5,6)7/h8-9,11-12,15-16,20H,1,10,13-14,17H2,2-7H3,(H,26,29) |
| InChIKey | YUSGYHVQIWJWLG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|