C26H39BrN4O5Si — CID 77183760
tert-butyl N-[1-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate (PubChem CID 77183760) has the molecular formula C26H39BrN4O5Si and a molecular weight of 595.61 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 77183760 |
| Molecular Formula | C26H39BrN4O5Si |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | tert-butyl N-[1-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)c1nc(-c2ccc(NC(=O)OC)cc2Br)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H39BrN4O5Si/c1-9-10-21(30-25(33)36-26(2,3)4)23-29-22(16-31(23)17-35-13-14-37(6,7)8)19-12-11-18(15-20(19)27)28-24(32)34-5/h9,11-12,15-16,21H,1,10,13-14,17H2,2-8H3,(H,28,32)(H,30,33) |
| InChIKey | PZSZQHVLJHIMCT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|