C28H40N4O6Si — CID 140936903
ethyl 2-[4-[2-(but-3-enoylamino)-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate (PubChem CID 140936903) has the molecular formula C28H40N4O6Si and a molecular weight of 556.74 g/mol. Its IUPAC name is ethyl 2-[4-[2-(but-3-enoylamino)-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate.
| Compound Name | ethyl 2-[4-[2-(but-3-enoylamino)-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 140936903 |
| Molecular Formula | C28H40N4O6Si |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | ethyl 2-[4-[2-(but-3-enoylamino)-4-(methoxycarbonylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate |
| SMILES | C=CCC(=O)Nc1cc(NC(=O)OC)ccc1-c1cn(COCC[Si](C)(C)C)c(C(CC=C)C(=O)OCC)n1 |
| InChI | InChI=1S/C28H40N4O6Si/c1-8-11-22(27(34)38-10-3)26-31-24(18-32(26)19-37-15-16-39(5,6)7)21-14-13-20(29-28(35)36-4)17-23(21)30-25(33)12-9-2/h8-9,13-14,17-18,22H,1-2,10-12,15-16,19H2,3-7H3,(H,29,35)(H,30,33) |
| InChIKey | KTBQNVCREZEFIF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|