C18H20N2O5 — CID 145303860
ethyl 2-[5-[4-(methoxycarbonylamino)phenyl]-1,3-oxazol-2-yl]pent-4-enoate (PubChem CID 145303860) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is ethyl 2-[5-[4-(methoxycarbonylamino)phenyl]-1,3-oxazol-2-yl]pent-4-enoate.
| Compound Name | ethyl 2-[5-[4-(methoxycarbonylamino)phenyl]-1,3-oxazol-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 145303860 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl 2-[5-[4-(methoxycarbonylamino)phenyl]-1,3-oxazol-2-yl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OCC)c1ncc(-c2ccc(NC(=O)OC)cc2)o1 |
| InChI | InChI=1S/C18H20N2O5/c1-4-6-14(17(21)24-5-2)16-19-11-15(25-16)12-7-9-13(10-8-12)20-18(22)23-3/h4,7-11,14H,1,5-6H2,2-3H3,(H,20,22) |
| InChIKey | ZDHJSOPJJSRCIX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|