C18H19N3O4 — CID 129080451
2-[2-[2-amino-4-(methoxycarbonylamino)phenyl]-4-pyridinyl]pent-4-enoic acid (PubChem CID 129080451) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[2-[2-amino-4-(methoxycarbonylamino)phenyl]-4-pyridinyl]pent-4-enoic acid.
| Compound Name | 2-[2-[2-amino-4-(methoxycarbonylamino)phenyl]-4-pyridinyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 129080451 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[2-[2-amino-4-(methoxycarbonylamino)phenyl]-4-pyridinyl]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)c1ccnc(-c2ccc(NC(=O)OC)cc2N)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-3-4-13(17(22)23)11-7-8-20-16(9-11)14-6-5-12(10-15(14)19)21-18(24)25-2/h3,5-10,13H,1,4,19H2,2H3,(H,21,24)(H,22,23) |
| InChIKey | NUKMXXSJLFACSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|