C19H16ClN5O3 — CID 175147104
methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate (PubChem CID 175147104) has the molecular formula C19H16ClN5O3 and a molecular weight of 397.82 g/mol. Its IUPAC name is methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate.
| Compound Name | methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate |
|---|---|
| PubChem CID | 175147104 |
| Molecular Formula | C19H16ClN5O3 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cc(C(=O)Nc3ccc(Cl)cn3)ccn2)c(N)c1 |
| InChI | InChI=1S/C19H16ClN5O3/c1-28-19(27)24-13-3-4-14(15(21)9-13)16-8-11(6-7-22-16)18(26)25-17-5-2-12(20)10-23-17/h2-10H,21H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | KLMODOQZPRYAGN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|