C24H23BrClN5O4 — CID 175146065
methyl N-[3-(5-bromopentanoylamino)-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate (PubChem CID 175146065) has the molecular formula C24H23BrClN5O4 and a molecular weight of 560.84 g/mol. Its IUPAC name is methyl N-[3-(5-bromopentanoylamino)-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate.
| Compound Name | methyl N-[3-(5-bromopentanoylamino)-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate |
|---|---|
| PubChem CID | 175146065 |
| Molecular Formula | C24H23BrClN5O4 |
| Molecular Weight | 560.84 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | methyl N-[3-(5-bromopentanoylamino)-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-pyridinyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cc(C(=O)Nc3ccc(Cl)cn3)ccn2)c(NC(=O)CCCCBr)c1 |
| InChI | InChI=1S/C24H23BrClN5O4/c1-35-24(34)29-17-6-7-18(20(13-17)30-22(32)4-2-3-10-25)19-12-15(9-11-27-19)23(33)31-21-8-5-16(26)14-28-21/h5-9,11-14H,2-4,10H2,1H3,(H,29,34)(H,30,32)(H,28,31,33) |
| InChIKey | PBVNCUBVIXVUNU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.84 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|