C17H15ClN6O3 — CID 175358972
methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]pyrazol-1-yl]phenyl]carbamate (PubChem CID 175358972) has the molecular formula C17H15ClN6O3 and a molecular weight of 386.80 g/mol. Its IUPAC name is methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]pyrazol-1-yl]phenyl]carbamate.
| Compound Name | methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]pyrazol-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 175358972 |
| Molecular Formula | C17H15ClN6O3 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl N-[3-amino-4-[4-[(5-chloro-2-pyridinyl)carbamoyl]pyrazol-1-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-n2cc(C(=O)Nc3ccc(Cl)cn3)cn2)c(N)c1 |
| InChI | InChI=1S/C17H15ClN6O3/c1-27-17(26)22-12-3-4-14(13(19)6-12)24-9-10(7-21-24)16(25)23-15-5-2-11(18)8-20-15/h2-9H,19H2,1H3,(H,22,26)(H,20,23,25) |
| InChIKey | RVDKYLOOBQCMPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|