C15H10Cl2N4O — CID 68934305
1-(2,4-dichlorophenyl)-N-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 68934305) has the molecular formula C15H10Cl2N4O and a molecular weight of 333.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-N-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 68934305 |
| Molecular Formula | C15H10Cl2N4O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cnn(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N4O/c16-11-4-5-13(12(17)7-11)21-9-10(8-19-21)15(22)20-14-3-1-2-6-18-14/h1-9H,(H,18,20,22) |
| InChIKey | CUMLXTPZVNTKFR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |