C18H13Cl2N3O3 — CID 154863010
2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-phenylacetic acid (PubChem CID 154863010) has the molecular formula C18H13Cl2N3O3 and a molecular weight of 390.23 g/mol. Its IUPAC name is 2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 154863010 |
| Molecular Formula | C18H13Cl2N3O3 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-phenylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccccc1)c1cnn(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H13Cl2N3O3/c19-13-6-7-15(14(20)8-13)23-10-12(9-21-23)17(24)22-16(18(25)26)11-4-2-1-3-5-11/h1-10,16H,(H,22,24)(H,25,26) |
| InChIKey | FTWFKEWVWHEJAZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |