C17H17Cl2N3O4 — CID 120548176
2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120548176) has the molecular formula C17H17Cl2N3O4 and a molecular weight of 398.25 g/mol. Its IUPAC name is 2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120548176 |
| Molecular Formula | C17H17Cl2N3O4 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-[[1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CCCOC1)c1cnn(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O4/c18-12-3-4-14(13(19)6-12)22-8-11(7-20-22)16(23)21-15(17(24)25)10-2-1-5-26-9-10/h3-4,6-8,10,15H,1-2,5,9H2,(H,21,23)(H,24,25) |
| InChIKey | ONJROXLDRKPWFZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |