C20H20ClNO5 — CID 120547587
2-[[3-(4-chlorophenoxy)benzoyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547587) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenoxy)benzoyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[3-(4-chlorophenoxy)benzoyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547587 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-[[3-(4-chlorophenoxy)benzoyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CCCOC1)c1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H20ClNO5/c21-15-6-8-16(9-7-15)27-17-5-1-3-13(11-17)19(23)22-18(20(24)25)14-4-2-10-26-12-14/h1,3,5-9,11,14,18H,2,4,10,12H2,(H,22,23)(H,24,25) |
| InChIKey | VTHFUYGXZHYEHT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |