C15H11ClINO3 — CID 103804402
(2R)-2-[(5-chloro-2-iodobenzoyl)amino]-2-phenylacetic acid (PubChem CID 103804402) has the molecular formula C15H11ClINO3 and a molecular weight of 415.61 g/mol. Its IUPAC name is (2R)-2-[(5-chloro-2-iodobenzoyl)amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(5-chloro-2-iodobenzoyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 103804402 |
| Molecular Formula | C15H11ClINO3 |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | (2R)-2-[(5-chloro-2-iodobenzoyl)amino]-2-phenylacetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)c1ccccc1)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C15H11ClINO3/c16-10-6-7-12(17)11(8-10)14(19)18-13(15(20)21)9-4-2-1-3-5-9/h1-8,13H,(H,18,19)(H,20,21)/t13-/m1/s1 |
| InChIKey | HRSLDPJVNCOWSK-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|