C13H11ClFN3O2 — CID 113019008
methyl N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]carbamate (PubChem CID 113019008) has the molecular formula C13H11ClFN3O2 and a molecular weight of 295.70 g/mol. Its IUPAC name is methyl N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]carbamate.
| Compound Name | methyl N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113019008 |
| Molecular Formula | C13H11ClFN3O2 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | methyl N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2ccc(F)c(Cl)c2)nc1 |
| InChI | InChI=1S/C13H11ClFN3O2/c1-20-13(19)18-9-3-5-12(16-7-9)17-8-2-4-11(15)10(14)6-8/h2-7H,1H3,(H,16,17)(H,18,19) |
| InChIKey | IBMZVLPNJNREDC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |