C18H21N3O3 — CID 159259588
methyl N-[3-amino-4-[2-(2-oxohex-5-en-3-yl)-3H-pyrrol-5-yl]phenyl]carbamate (PubChem CID 159259588) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl N-[3-amino-4-[2-(2-oxohex-5-en-3-yl)-3H-pyrrol-5-yl]phenyl]carbamate.
| Compound Name | methyl N-[3-amino-4-[2-(2-oxohex-5-en-3-yl)-3H-pyrrol-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 159259588 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | methyl N-[3-amino-4-[2-(2-oxohex-5-en-3-yl)-3H-pyrrol-5-yl]phenyl]carbamate |
| SMILES | C=CCC(C(C)=O)C1=NC(c2ccc(NC(=O)OC)cc2N)=CC1 |
| InChI | InChI=1S/C18H21N3O3/c1-4-5-13(11(2)22)16-8-9-17(21-16)14-7-6-12(10-15(14)19)20-18(23)24-3/h4,6-7,9-10,13H,1,5,8,19H2,2-3H3,(H,20,23) |
| InChIKey | WLPVNLXUDMYKLG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|