C10H11N3O3 — CID 13027362
methyl N-(3-amino-2H-1,4-benzoxazin-7-yl)carbamate (PubChem CID 13027362) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is methyl N-(3-amino-2H-1,4-benzoxazin-7-yl)carbamate.
| Compound Name | methyl N-(3-amino-2H-1,4-benzoxazin-7-yl)carbamate |
|---|---|
| PubChem CID | 13027362 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | methyl N-(3-amino-2H-1,4-benzoxazin-7-yl)carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)OCC(N)=N2 |
| InChI | InChI=1S/C10H11N3O3/c1-15-10(14)12-6-2-3-7-8(4-6)16-5-9(11)13-7/h2-4H,5H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | ORGFPELXAOITDW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |