C17H18N2O3 — CID 90357824
tert-butyl N-(5H-chromeno[3,4-c]pyridin-8-yl)carbamate (PubChem CID 90357824) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl N-(5H-chromeno[3,4-c]pyridin-8-yl)carbamate.
| Compound Name | tert-butyl N-(5H-chromeno[3,4-c]pyridin-8-yl)carbamate |
|---|---|
| PubChem CID | 90357824 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | tert-butyl N-(5H-chromeno[3,4-c]pyridin-8-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(c1)OCc1cnccc1-2 |
| InChI | InChI=1S/C17H18N2O3/c1-17(2,3)22-16(20)19-12-4-5-14-13-6-7-18-9-11(13)10-21-15(14)8-12/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | JDHDBMDRMLKURQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |