C18H19N3O5 — CID 166597114
tert-butyl N-[5-(1,3-benzodioxol-5-ylcarbamoyl)-2-pyridinyl]carbamate (PubChem CID 166597114) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is tert-butyl N-[5-(1,3-benzodioxol-5-ylcarbamoyl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-(1,3-benzodioxol-5-ylcarbamoyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 166597114 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | tert-butyl N-[5-(1,3-benzodioxol-5-ylcarbamoyl)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)Nc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C18H19N3O5/c1-18(2,3)26-17(23)21-15-7-4-11(9-19-15)16(22)20-12-5-6-13-14(8-12)25-10-24-13/h4-9H,10H2,1-3H3,(H,20,22)(H,19,21,23) |
| InChIKey | QVFYRZJIDTXULL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |