About 3-amino-2H-1,4-benzoxazin-7-ol
3-amino-2H-1,4-benzoxazin-7-ol (PubChem CID 115012899) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-amino-2H-1,4-benzoxazin-7-ol.
Molecular Properties
| Compound Name | 3-amino-2H-1,4-benzoxazin-7-ol |
| PubChem CID | 115012899 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3-amino-2H-1,4-benzoxazin-7-ol |
| SMILES | NC1=Nc2ccc(O)cc2OC1 |
| InChI | InChI=1S/C8H8N2O2/c9-8-4-12-7-3-5(11)1-2-6(7)10-8/h1-3,11H,4H2,(H2,9,10) |
| InChIKey | BOVSKHHSVVSRKT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2H-1,4-benzoxazin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2H-1,4-benzoxazin-7-ol?
The IUPAC name of 3-amino-2H-1,4-benzoxazin-7-ol (CID 115012899) is 3-amino-2H-1,4-benzoxazin-7-ol.
What is the SMILES notation for 3-amino-2H-1,4-benzoxazin-7-ol?
The canonical SMILES for 3-amino-2H-1,4-benzoxazin-7-ol is NC1=Nc2ccc(O)cc2OC1.
What is the InChIKey of 3-amino-2H-1,4-benzoxazin-7-ol?
The InChIKey is BOVSKHHSVVSRKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c9-8-4-12-7-3-5(11)1-2-6(7)10-8/h1-3,11H,4H2,(H2,9,10).
What are the key properties of 3-amino-2H-1,4-benzoxazin-7-ol?
3-amino-2H-1,4-benzoxazin-7-ol has a molecular weight of 164.16 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2H-1,4-benzoxazin-7-ol is sourced from PubChem (CID 115012899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).